C15H18N2O4 — CID 115462958
2-[2-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]phenyl]acetic acid (PubChem CID 115462958) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[2-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 115462958 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[2-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]phenyl]acetic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1Cc1ccccc1CC(=O)O |
| InChI | InChI=1S/C15H18N2O4/c1-15(2)14(21)16-12(18)9-17(15)8-11-6-4-3-5-10(11)7-13(19)20/h3-6H,7-9H2,1-2H3,(H,19,20)(H,16,18,21) |
| InChIKey | BUIYBQWRMPMECY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|