C13H16N2O5 — CID 66076326
4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 66076326) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 66076326 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1CN1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C13H16N2O5/c1-7-8(4-9(20-7)11(17)18)5-15-6-10(16)14-12(19)13(15,2)3/h4H,5-6H2,1-3H3,(H,17,18)(H,14,16,19) |
| InChIKey | UBPOOPBBTAWBIB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|