C14H15FN2O4 — CID 106699342
4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-2-fluorobenzoic acid (PubChem CID 106699342) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-2-fluorobenzoic acid.
| Compound Name | 4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 106699342 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[(2,2-dimethyl-3,5-dioxopiperazin-1-yl)methyl]-2-fluorobenzoic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1Cc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C14H15FN2O4/c1-14(2)13(21)16-11(18)7-17(14)6-8-3-4-9(12(19)20)10(15)5-8/h3-5H,6-7H2,1-2H3,(H,19,20)(H,16,18,21) |
| InChIKey | KWDZRJNXKLLFAH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|