C16H20N2O — CID 114481439
3-methyl-4-[(2-oxo-4-propylpyrrolidin-1-yl)methyl]benzonitrile (PubChem CID 114481439) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-methyl-4-[(2-oxo-4-propylpyrrolidin-1-yl)methyl]benzonitrile.
| Compound Name | 3-methyl-4-[(2-oxo-4-propylpyrrolidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 114481439 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-methyl-4-[(2-oxo-4-propylpyrrolidin-1-yl)methyl]benzonitrile |
| SMILES | CCCC1CC(=O)N(Cc2ccc(C#N)cc2C)C1 |
| InChI | InChI=1S/C16H20N2O/c1-3-4-14-8-16(19)18(10-14)11-15-6-5-13(9-17)7-12(15)2/h5-7,14H,3-4,8,10-11H2,1-2H3 |
| InChIKey | IYMUDKSLFKZFEY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |