C27H29N3O6 — CID 46034878
N-butyl-2-[[6-[2-(3,4-dimethylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 46034878) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is N-butyl-2-[[6-[2-(3,4-dimethylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-butyl-2-[[6-[2-(3,4-dimethylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46034878 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-butyl-2-[[6-[2-(3,4-dimethylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1coc(CN2C(=O)COc3ccc(C(=O)COc4ccc(C)c(C)c4)cc32)n1 |
| InChI | InChI=1S/C27H29N3O6/c1-4-5-10-28-27(33)21-14-36-25(29-21)13-30-22-12-19(7-9-24(22)35-16-26(30)32)23(31)15-34-20-8-6-17(2)18(3)11-20/h6-9,11-12,14H,4-5,10,13,15-16H2,1-3H3,(H,28,33) |
| InChIKey | MHDYNKYKCXPREX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|