C15H10F2INO — CID 79787371
1-[(2,5-difluorophenyl)methyl]-5-iodo-3H-indol-2-one (PubChem CID 79787371) has the molecular formula C15H10F2INO and a molecular weight of 385.15 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-5-iodo-3H-indol-2-one.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-5-iodo-3H-indol-2-one |
|---|---|
| PubChem CID | 79787371 |
| Molecular Formula | C15H10F2INO |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-5-iodo-3H-indol-2-one |
| SMILES | O=C1Cc2cc(I)ccc2N1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C15H10F2INO/c16-11-1-3-13(17)10(5-11)8-19-14-4-2-12(18)6-9(14)7-15(19)20/h1-6H,7-8H2 |
| InChIKey | JMGABIMDFRHIFL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|