C13H16INO3S — CID 79787473
7-iodo-1-(2-methylsulfonylethyl)-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 79787473) has the molecular formula C13H16INO3S and a molecular weight of 393.25 g/mol. Its IUPAC name is 7-iodo-1-(2-methylsulfonylethyl)-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 7-iodo-1-(2-methylsulfonylethyl)-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 79787473 |
| Molecular Formula | C13H16INO3S |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 7-iodo-1-(2-methylsulfonylethyl)-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CS(=O)(=O)CCN1C(=O)CCCc2cc(I)ccc21 |
| InChI | InChI=1S/C13H16INO3S/c1-19(17,18)8-7-15-12-6-5-11(14)9-10(12)3-2-4-13(15)16/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | IMFXYLAIASMVCQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|