C13H15N3O — CID 43446567
4-(6-amino-2-oxo-3,4-dihydroquinolin-1-yl)butanenitrile (PubChem CID 43446567) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-(6-amino-2-oxo-3,4-dihydroquinolin-1-yl)butanenitrile.
| Compound Name | 4-(6-amino-2-oxo-3,4-dihydroquinolin-1-yl)butanenitrile |
|---|---|
| PubChem CID | 43446567 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-(6-amino-2-oxo-3,4-dihydroquinolin-1-yl)butanenitrile |
| SMILES | N#CCCCN1C(=O)CCc2cc(N)ccc21 |
| InChI | InChI=1S/C13H15N3O/c14-7-1-2-8-16-12-5-4-11(15)9-10(12)3-6-13(16)17/h4-5,9H,1-3,6,8,15H2 |
| InChIKey | GMKLOALMVWSCTL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|