C18H28N2O — CID 170870224
4-[3-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)propyl]morpholine (PubChem CID 170870224) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 4-[3-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)propyl]morpholine.
| Compound Name | 4-[3-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)propyl]morpholine |
|---|---|
| PubChem CID | 170870224 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 4-[3-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)propyl]morpholine |
| SMILES | CCN1CCCc2cc(CCCN3CCOCC3)ccc21 |
| InChI | InChI=1S/C18H28N2O/c1-2-20-10-4-6-17-15-16(7-8-18(17)20)5-3-9-19-11-13-21-14-12-19/h7-8,15H,2-6,9-14H2,1H3 |
| InChIKey | HVNFBKVAQILALM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |