C16H21N — CID 66772198
1-cyclohexyl-5-ethenyl-2,3-dihydroindole (PubChem CID 66772198) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-cyclohexyl-5-ethenyl-2,3-dihydroindole.
| Compound Name | 1-cyclohexyl-5-ethenyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 66772198 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 1-cyclohexyl-5-ethenyl-2,3-dihydroindole |
| SMILES | C=Cc1ccc2c(c1)CCN2C1CCCCC1 |
| InChI | InChI=1S/C16H21N/c1-2-13-8-9-16-14(12-13)10-11-17(16)15-6-4-3-5-7-15/h2,8-9,12,15H,1,3-7,10-11H2 |
| InChIKey | FBYQDRQIYKBRIK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|