C13H18N2 — CID 115115080
(1-cyclobutyl-2,3-dihydroindol-5-yl)methanamine (PubChem CID 115115080) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (1-cyclobutyl-2,3-dihydroindol-5-yl)methanamine.
| Compound Name | (1-cyclobutyl-2,3-dihydroindol-5-yl)methanamine |
|---|---|
| PubChem CID | 115115080 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (1-cyclobutyl-2,3-dihydroindol-5-yl)methanamine |
| SMILES | NCc1ccc2c(c1)CCN2C1CCC1 |
| InChI | InChI=1S/C13H18N2/c14-9-10-4-5-13-11(8-10)6-7-15(13)12-2-1-3-12/h4-5,8,12H,1-3,6-7,9,14H2 |
| InChIKey | HPHHWDQBDMXQCK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |