C15H22N2 — CID 115115356
2-(1-cyclopentyl-2,3-dihydroindol-5-yl)ethanamine (PubChem CID 115115356) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-(1-cyclopentyl-2,3-dihydroindol-5-yl)ethanamine.
| Compound Name | 2-(1-cyclopentyl-2,3-dihydroindol-5-yl)ethanamine |
|---|---|
| PubChem CID | 115115356 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-(1-cyclopentyl-2,3-dihydroindol-5-yl)ethanamine |
| SMILES | NCCc1ccc2c(c1)CCN2C1CCCC1 |
| InChI | InChI=1S/C15H22N2/c16-9-7-12-5-6-15-13(11-12)8-10-17(15)14-3-1-2-4-14/h5-6,11,14H,1-4,7-10,16H2 |
| InChIKey | HDIFRIYZSNNOCF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |