C12H18N2 — CID 62095510
3-(1-methyl-2,3-dihydroindol-5-yl)propan-1-amine (PubChem CID 62095510) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-(1-methyl-2,3-dihydroindol-5-yl)propan-1-amine.
| Compound Name | 3-(1-methyl-2,3-dihydroindol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 62095510 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3-(1-methyl-2,3-dihydroindol-5-yl)propan-1-amine |
| SMILES | CN1CCc2cc(CCCN)ccc21 |
| InChI | InChI=1S/C12H18N2/c1-14-8-6-11-9-10(3-2-7-13)4-5-12(11)14/h4-5,9H,2-3,6-8,13H2,1H3 |
| InChIKey | UAKBFRHIDPANCS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |