C16H23NO — CID 117118466
1-(1-cyclohexyl-2,3-dihydroindol-5-yl)ethanol (PubChem CID 117118466) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-(1-cyclohexyl-2,3-dihydroindol-5-yl)ethanol.
| Compound Name | 1-(1-cyclohexyl-2,3-dihydroindol-5-yl)ethanol |
|---|---|
| PubChem CID | 117118466 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 1-(1-cyclohexyl-2,3-dihydroindol-5-yl)ethanol |
| SMILES | CC(O)c1ccc2c(c1)CCN2C1CCCCC1 |
| InChI | InChI=1S/C16H23NO/c1-12(18)13-7-8-16-14(11-13)9-10-17(16)15-5-3-2-4-6-15/h7-8,11-12,15,18H,2-6,9-10H2,1H3 |
| InChIKey | WNGKRMQWZAJHAK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|