C15H19N3 — CID 130440298
1-ethyl-6-(5-methyl-1H-pyrazol-3-yl)-3,4-dihydro-2H-quinoline (PubChem CID 130440298) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-ethyl-6-(5-methyl-1H-pyrazol-3-yl)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-ethyl-6-(5-methyl-1H-pyrazol-3-yl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 130440298 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-ethyl-6-(5-methyl-1H-pyrazol-3-yl)-3,4-dihydro-2H-quinoline |
| SMILES | CCN1CCCc2cc(-c3cc(C)[nH]n3)ccc21 |
| InChI | InChI=1S/C15H19N3/c1-3-18-8-4-5-13-10-12(6-7-15(13)18)14-9-11(2)16-17-14/h6-7,9-10H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | HCCGXCFHAGXODV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |