C20H24N2S — CID 171488399
N-(4-ethenylphenyl)sulfanyl-1-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methanamine (PubChem CID 171488399) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is N-(4-ethenylphenyl)sulfanyl-1-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methanamine.
| Compound Name | N-(4-ethenylphenyl)sulfanyl-1-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methanamine |
|---|---|
| PubChem CID | 171488399 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-(4-ethenylphenyl)sulfanyl-1-(1-ethyl-3,4-dihydro-2H-quinolin-6-yl)methanamine |
| SMILES | C=Cc1ccc(SNCc2ccc3c(c2)CCCN3CC)cc1 |
| InChI | InChI=1S/C20H24N2S/c1-3-16-7-10-19(11-8-16)23-21-15-17-9-12-20-18(14-17)6-5-13-22(20)4-2/h3,7-12,14,21H,1,4-6,13,15H2,2H3 |
| InChIKey | XBVKYILXKWREOL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|