C14H20F3N — CID 143643842
ethane;1-ethyl-7-(trifluoromethyl)-3,4-dihydro-2H-quinoline (PubChem CID 143643842) has the molecular formula C14H20F3N and a molecular weight of 259.31 g/mol. Its IUPAC name is ethane;1-ethyl-7-(trifluoromethyl)-3,4-dihydro-2H-quinoline.
| Compound Name | ethane;1-ethyl-7-(trifluoromethyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 143643842 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | ethane;1-ethyl-7-(trifluoromethyl)-3,4-dihydro-2H-quinoline |
| SMILES | CC.CCN1CCCc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C12H14F3N.C2H6/c1-2-16-7-3-4-9-5-6-10(8-11(9)16)12(13,14)15;1-2/h5-6,8H,2-4,7H2,1H3;1-2H3 |
| InChIKey | FUQDTOJDTULFPI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |