C12H14F3NO — CID 6926181
(4R)-1-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 6926181) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is (4R)-1-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | (4R)-1-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 6926181 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | (4R)-1-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | CCN1CC[C@@H](O)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C12H14F3NO/c1-2-16-6-5-11(17)9-7-8(12(13,14)15)3-4-10(9)16/h3-4,7,11,17H,2,5-6H2,1H3/t11-/m1/s1 |
| InChIKey | HGYZSIFSAJUBPM-LLVKDONJSA-N |
| XLogP | 2.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |