C14H20N2O2 — CID 79161867
N,N-diethyl-8-hydroxy-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 79161867) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N,N-diethyl-8-hydroxy-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N,N-diethyl-8-hydroxy-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 79161867 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N,N-diethyl-8-hydroxy-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCCc2cccc(O)c21 |
| InChI | InChI=1S/C14H20N2O2/c1-3-15(4-2)14(18)16-10-6-8-11-7-5-9-12(17)13(11)16/h5,7,9,17H,3-4,6,8,10H2,1-2H3 |
| InChIKey | DZTROBOTMUMCLB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |