C13H13NO2 — CID 106741641
1-(8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)but-2-yn-1-one (PubChem CID 106741641) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-(8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)but-2-yn-1-one.
| Compound Name | 1-(8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)but-2-yn-1-one |
|---|---|
| PubChem CID | 106741641 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1-(8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCc2cccc(O)c21 |
| InChI | InChI=1S/C13H13NO2/c1-2-5-12(16)14-9-4-7-10-6-3-8-11(15)13(10)14/h3,6,8,15H,4,7,9H2,1H3 |
| InChIKey | WUZSZAIGZLUUJH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|