C10H9BrClNO3S — CID 45156700
1-acetyl-5-bromo-2,3-dihydroindole-7-sulfonyl chloride (PubChem CID 45156700) has the molecular formula C10H9BrClNO3S and a molecular weight of 338.61 g/mol. Its IUPAC name is 1-acetyl-5-bromo-2,3-dihydroindole-7-sulfonyl chloride.
| Compound Name | 1-acetyl-5-bromo-2,3-dihydroindole-7-sulfonyl chloride |
|---|---|
| PubChem CID | 45156700 |
| Molecular Formula | C10H9BrClNO3S |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 336.92 |
| IUPAC Name | 1-acetyl-5-bromo-2,3-dihydroindole-7-sulfonyl chloride |
| SMILES | CC(=O)N1CCc2cc(Br)cc(S(=O)(=O)Cl)c21 |
| InChI | InChI=1S/C10H9BrClNO3S/c1-6(14)13-3-2-7-4-8(11)5-9(10(7)13)17(12,15)16/h4-5H,2-3H2,1H3 |
| InChIKey | OCQLARLEGOFXFN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |