C18H27BrN2O3S — CID 3267786
1-acetyl-5-bromo-N,N-dibutyl-2,3-dihydroindole-7-sulfonamide (PubChem CID 3267786) has the molecular formula C18H27BrN2O3S and a molecular weight of 431.40 g/mol. Its IUPAC name is 1-acetyl-5-bromo-N,N-dibutyl-2,3-dihydroindole-7-sulfonamide.
| Compound Name | 1-acetyl-5-bromo-N,N-dibutyl-2,3-dihydroindole-7-sulfonamide |
|---|---|
| PubChem CID | 3267786 |
| Molecular Formula | C18H27BrN2O3S |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-acetyl-5-bromo-N,N-dibutyl-2,3-dihydroindole-7-sulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1cc(Br)cc2c1N(C(C)=O)CC2 |
| InChI | InChI=1S/C18H27BrN2O3S/c1-4-6-9-20(10-7-5-2)25(23,24)17-13-16(19)12-15-8-11-21(14(3)22)18(15)17/h12-13H,4-11H2,1-3H3 |
| InChIKey | PQNMMGPXBSIJJL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |