C11H12BrNO2 — CID 82379295
1-(5-bromo-7-methoxy-2,3-dihydroindol-1-yl)ethanone (PubChem CID 82379295) has the molecular formula C11H12BrNO2 and a molecular weight of 270.13 g/mol. Its IUPAC name is 1-(5-bromo-7-methoxy-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-(5-bromo-7-methoxy-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 82379295 |
| Molecular Formula | C11H12BrNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 1-(5-bromo-7-methoxy-2,3-dihydroindol-1-yl)ethanone |
| SMILES | COc1cc(Br)cc2c1N(C(C)=O)CC2 |
| InChI | InChI=1S/C11H12BrNO2/c1-7(14)13-4-3-8-5-9(12)6-10(15-2)11(8)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | DJQHBZSQNSSZKU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |