C23H24N4OS — CID 141146332
1-[5-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 141146332) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is 1-[5-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 141146332 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[5-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(N3CCN(c4nc(-c5ccccc5)cs4)CC3)ccc21 |
| InChI | InChI=1S/C23H24N4OS/c1-17(28)27-10-9-19-15-20(7-8-22(19)27)25-11-13-26(14-12-25)23-24-21(16-29-23)18-5-3-2-4-6-18/h2-8,15-16H,9-14H2,1H3 |
| InChIKey | DODMFTBBLPKDSF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|