C35H44N6O2 — CID 161177802
1-[5-(4-benzylpiperazin-1-yl)-2,3-dihydroindol-1-yl]ethanone;1-(6-piperazin-1-yl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 161177802) has the molecular formula C35H44N6O2 and a molecular weight of 580.78 g/mol. Its IUPAC name is 1-[5-(4-benzylpiperazin-1-yl)-2,3-dihydroindol-1-yl]ethanone;1-(6-piperazin-1-yl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 1-[5-(4-benzylpiperazin-1-yl)-2,3-dihydroindol-1-yl]ethanone;1-(6-piperazin-1-yl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 161177802 |
| Molecular Formula | C35H44N6O2 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | 1-[5-(4-benzylpiperazin-1-yl)-2,3-dihydroindol-1-yl]ethanone;1-(6-piperazin-1-yl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)N1CCc2cc(N3CCN(Cc4ccccc4)CC3)ccc21.CC(=O)N1CCc2ccc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C21H25N3O.C14H19N3O/c1-17(25)24-10-9-19-15-20(7-8-21(19)24)23-13-11-22(12-14-23)16-18-5-3-2-4-6-18;1-11(18)17-7-4-12-2-3-13(10-14(12)17)16-8-5-15-6-9-16/h2-8,15H,9-14,16H2,1H3;2-3,10,15H,4-9H2,1H3 |
| InChIKey | USAVAKFEPKSSEI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|