C11H14Br2ClNO2 — CID 171235118
4-[(1S)-1-aminobut-3-enyl]-2,3-dibromo-6-methoxyphenol;hydrochloride (PubChem CID 171235118) has the molecular formula C11H14Br2ClNO2 and a molecular weight of 387.50 g/mol. Its IUPAC name is 4-[(1S)-1-aminobut-3-enyl]-2,3-dibromo-6-methoxyphenol;hydrochloride.
| Compound Name | 4-[(1S)-1-aminobut-3-enyl]-2,3-dibromo-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171235118 |
| Molecular Formula | C11H14Br2ClNO2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | 4-[(1S)-1-aminobut-3-enyl]-2,3-dibromo-6-methoxyphenol;hydrochloride |
| SMILES | C=CC[C@H](N)c1cc(OC)c(O)c(Br)c1Br.Cl |
| InChI | InChI=1S/C11H13Br2NO2.ClH/c1-3-4-7(14)6-5-8(16-2)11(15)10(13)9(6)12;/h3,5,7,15H,1,4,14H2,2H3;1H/t7-;/m0./s1 |
| InChIKey | JRLOEOBHRUVBIV-FJXQXJEOSA-N |
| XLogP | 3.92 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|