C10H13Br2NO3 — CID 170874488
4-(1-amino-3-hydroxypropyl)-2,3-dibromo-6-methoxyphenol (PubChem CID 170874488) has the molecular formula C10H13Br2NO3 and a molecular weight of 355.03 g/mol. Its IUPAC name is 4-(1-amino-3-hydroxypropyl)-2,3-dibromo-6-methoxyphenol.
| Compound Name | 4-(1-amino-3-hydroxypropyl)-2,3-dibromo-6-methoxyphenol |
|---|---|
| PubChem CID | 170874488 |
| Molecular Formula | C10H13Br2NO3 |
| Molecular Weight | 355.03 g/mol |
| Exact Mass | 352.93 |
| IUPAC Name | 4-(1-amino-3-hydroxypropyl)-2,3-dibromo-6-methoxyphenol |
| SMILES | COc1cc(C(N)CCO)c(Br)c(Br)c1O |
| InChI | InChI=1S/C10H13Br2NO3/c1-16-7-4-5(6(13)2-3-14)8(11)9(12)10(7)15/h4,6,14-15H,2-3,13H2,1H3 |
| InChIKey | JDYBVQGHRCJUNL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.03 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |