C12H17Br2NO2 — CID 171235148
4-[(1S)-1-amino-2-methylbutyl]-2,3-dibromo-6-methoxyphenol (PubChem CID 171235148) has the molecular formula C12H17Br2NO2 and a molecular weight of 367.08 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2-methylbutyl]-2,3-dibromo-6-methoxyphenol.
| Compound Name | 4-[(1S)-1-amino-2-methylbutyl]-2,3-dibromo-6-methoxyphenol |
|---|---|
| PubChem CID | 171235148 |
| Molecular Formula | C12H17Br2NO2 |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | 4-[(1S)-1-amino-2-methylbutyl]-2,3-dibromo-6-methoxyphenol |
| SMILES | CCC(C)[C@H](N)c1cc(OC)c(O)c(Br)c1Br |
| InChI | InChI=1S/C12H17Br2NO2/c1-4-6(2)11(15)7-5-8(17-3)12(16)10(14)9(7)13/h5-6,11,16H,4,15H2,1-3H3/t6?,11-/m0/s1 |
| InChIKey | JFMMIIMVJZVLHG-NWFFHIACSA-N |
| XLogP | 3.97 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |