C11H12Br2F3NO2 — CID 171235129
4-[(1S)-1-amino-4,4,4-trifluorobutyl]-2,3-dibromo-6-methoxyphenol (PubChem CID 171235129) has the molecular formula C11H12Br2F3NO2 and a molecular weight of 407.02 g/mol. Its IUPAC name is 4-[(1S)-1-amino-4,4,4-trifluorobutyl]-2,3-dibromo-6-methoxyphenol.
| Compound Name | 4-[(1S)-1-amino-4,4,4-trifluorobutyl]-2,3-dibromo-6-methoxyphenol |
|---|---|
| PubChem CID | 171235129 |
| Molecular Formula | C11H12Br2F3NO2 |
| Molecular Weight | 407.02 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | 4-[(1S)-1-amino-4,4,4-trifluorobutyl]-2,3-dibromo-6-methoxyphenol |
| SMILES | COc1cc([C@@H](N)CCC(F)(F)F)c(Br)c(Br)c1O |
| InChI | InChI=1S/C11H12Br2F3NO2/c1-19-7-4-5(8(12)9(13)10(7)18)6(17)2-3-11(14,15)16/h4,6,18H,2-3,17H2,1H3/t6-/m0/s1 |
| InChIKey | JLOMDOMKBCNXMU-LURJTMIESA-N |
| XLogP | 4.27 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.02 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |