C12H8F6N2O2 — CID 22613354
3,7-diamino-1,5-bis(trifluoromethyl)naphthalene-2,6-diol (PubChem CID 22613354) has the molecular formula C12H8F6N2O2 and a molecular weight of 326.20 g/mol. Its IUPAC name is 3,7-diamino-1,5-bis(trifluoromethyl)naphthalene-2,6-diol.
| Compound Name | 3,7-diamino-1,5-bis(trifluoromethyl)naphthalene-2,6-diol |
|---|---|
| PubChem CID | 22613354 |
| Molecular Formula | C12H8F6N2O2 |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3,7-diamino-1,5-bis(trifluoromethyl)naphthalene-2,6-diol |
| SMILES | Nc1cc2c(C(F)(F)F)c(O)c(N)cc2c(C(F)(F)F)c1O |
| InChI | InChI=1S/C12H8F6N2O2/c13-11(14,15)7-3-1-5(19)9(21)8(12(16,17)18)4(3)2-6(20)10(7)22/h1-2,21-22H,19-20H2 |
| InChIKey | KYIUEEWCHKBBNJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|