C8H7NO2S — CID 84657940
6-amino-1-benzothiophene-4,5-diol (PubChem CID 84657940) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 6-amino-1-benzothiophene-4,5-diol.
| Compound Name | 6-amino-1-benzothiophene-4,5-diol |
|---|---|
| PubChem CID | 84657940 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 6-amino-1-benzothiophene-4,5-diol |
| SMILES | Nc1cc2sccc2c(O)c1O |
| InChI | InChI=1S/C8H7NO2S/c9-5-3-6-4(1-2-12-6)7(10)8(5)11/h1-3,10-11H,9H2 |
| InChIKey | QJINLVHITVIRMD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|