C9H8O3S — CID 130969866
5-(hydroxymethyl)-1-benzothiophene-4,6-diol (PubChem CID 130969866) has the molecular formula C9H8O3S and a molecular weight of 196.23 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1-benzothiophene-4,6-diol.
| Compound Name | 5-(hydroxymethyl)-1-benzothiophene-4,6-diol |
|---|---|
| PubChem CID | 130969866 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 5-(hydroxymethyl)-1-benzothiophene-4,6-diol |
| SMILES | OCc1c(O)cc2sccc2c1O |
| InChI | InChI=1S/C9H8O3S/c10-4-6-7(11)3-8-5(9(6)12)1-2-13-8/h1-3,10-12H,4H2 |
| InChIKey | IVAWMHSIJNCLBC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |