C10H6F9NO — CID 146469701
6-amino-3-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-(trifluoromethyl)phenol (PubChem CID 146469701) has the molecular formula C10H6F9NO and a molecular weight of 327.15 g/mol. Its IUPAC name is 6-amino-3-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-(trifluoromethyl)phenol.
| Compound Name | 6-amino-3-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 146469701 |
| Molecular Formula | C10H6F9NO |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 6-amino-3-(1,1,1,2,3,3-hexafluoropropan-2-yl)-2-(trifluoromethyl)phenol |
| SMILES | Nc1ccc(C(F)(C(F)F)C(F)(F)F)c(C(F)(F)F)c1O |
| InChI | InChI=1S/C10H6F9NO/c11-7(12)8(13,10(17,18)19)3-1-2-4(20)6(21)5(3)9(14,15)16/h1-2,7,21H,20H2 |
| InChIKey | HTMVMRDOOVRWSK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|