C17H10F12N2O2 — CID 23302169
2-amino-3-[4-amino-3-hydroxy-5-(trifluoromethyl)phenyl]-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)-5-(trifluoromethyl)phenol (PubChem CID 23302169) has the molecular formula C17H10F12N2O2 and a molecular weight of 502.26 g/mol. Its IUPAC name is 2-amino-3-[4-amino-3-hydroxy-5-(trifluoromethyl)phenyl]-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)-5-(trifluoromethyl)phenol.
| Compound Name | 2-amino-3-[4-amino-3-hydroxy-5-(trifluoromethyl)phenyl]-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 23302169 |
| Molecular Formula | C17H10F12N2O2 |
| Molecular Weight | 502.26 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 2-amino-3-[4-amino-3-hydroxy-5-(trifluoromethyl)phenyl]-4-(1,1,1,2,3,3-hexafluoropropan-2-yl)-5-(trifluoromethyl)phenol |
| SMILES | Nc1c(O)cc(-c2c(N)c(O)cc(C(F)(F)F)c2C(F)(C(F)F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H10F12N2O2/c18-13(19)14(20,17(27,28)29)10-5(15(21,22)23)3-8(33)12(31)9(10)4-1-6(16(24,25)26)11(30)7(32)2-4/h1-3,13,32-33H,30-31H2 |
| InChIKey | NAITVSSRGBHQRH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.26 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|