C15H9Br9O2S — CID 174906410
1,4-bis(tribromomethyl)benzene;tribromomethylsulfonylbenzene (PubChem CID 174906410) has the molecular formula C15H9Br9O2S and a molecular weight of 972.44 g/mol. Its IUPAC name is 1,4-bis(tribromomethyl)benzene;tribromomethylsulfonylbenzene.
| Compound Name | 1,4-bis(tribromomethyl)benzene;tribromomethylsulfonylbenzene |
|---|---|
| PubChem CID | 174906410 |
| Molecular Formula | C15H9Br9O2S |
| Molecular Weight | 972.44 g/mol |
| Exact Mass | 963.30 |
| IUPAC Name | 1,4-bis(tribromomethyl)benzene;tribromomethylsulfonylbenzene |
| SMILES | BrC(Br)(Br)c1ccc(C(Br)(Br)Br)cc1.O=S(=O)(c1ccccc1)C(Br)(Br)Br |
| InChI | InChI=1S/C8H4Br6.C7H5Br3O2S/c9-7(10,11)5-1-2-6(4-3-5)8(12,13)14;8-7(9,10)13(11,12)6-4-2-1-3-5-6/h1-4H;1-5H |
| InChIKey | JLGARCBXOKFKGW-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.44 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|