C9H12FNO3S — CID 115039399
3-(3-fluorophenyl)-2-hydroxypropane-1-sulfonamide (PubChem CID 115039399) has the molecular formula C9H12FNO3S and a molecular weight of 233.26 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-hydroxypropane-1-sulfonamide.
| Compound Name | 3-(3-fluorophenyl)-2-hydroxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 115039399 |
| Molecular Formula | C9H12FNO3S |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 3-(3-fluorophenyl)-2-hydroxypropane-1-sulfonamide |
| SMILES | NS(=O)(=O)CC(O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C9H12FNO3S/c10-8-3-1-2-7(4-8)5-9(12)6-15(11,13)14/h1-4,9,12H,5-6H2,(H2,11,13,14) |
| InChIKey | UFYVNIBUOMLDMI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |