C14H23NO4S — CID 71345032
2-(benzenesulfonyl)acetic acid;N,N-diethylethanamine (PubChem CID 71345032) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-(benzenesulfonyl)acetic acid;N,N-diethylethanamine.
| Compound Name | 2-(benzenesulfonyl)acetic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 71345032 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(benzenesulfonyl)acetic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.O=C(O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8O4S.C6H15N/c9-8(10)6-13(11,12)7-4-2-1-3-5-7;1-4-7(5-2)6-3/h1-5H,6H2,(H,9,10);4-6H2,1-3H3 |
| InChIKey | MEUQNDYKAIATMZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |