About benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene
benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene (PubChem CID 159600522) has the molecular formula C29H26O7S2
and a molecular weight of 550.65 g/mol. Its IUPAC name is benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene.
Molecular Properties
| Compound Name | benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene |
| PubChem CID | 159600522 |
| Molecular Formula | C29H26O7S2 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene |
| SMILES | O=C(O)CS(=O)(=O)c1ccccc1.O=Cc1ccccc1.O=S(=O)(C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O2S.C8H8O4S.C7H6O/c15-17(16,14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;9-8(10)6-13(11,12)7-4-2-1-3-5-7;8-6-7-4-2-1-3-5-7/h1-12H;1-5H,6H2,(H,9,10);1-6H |
| InChIKey | MLKMEWNCHUDCCI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene?
The IUPAC name of benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene (CID 159600522) is benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene.
What is the SMILES notation for benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene?
The canonical SMILES for benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene is O=C(O)CS(=O)(=O)c1ccccc1.O=Cc1ccccc1.O=S(=O)(C=Cc1ccccc1)c1ccccc1.
What is the InChIKey of benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene?
The InChIKey is MLKMEWNCHUDCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2S.C8H8O4S.C7H6O/c15-17(16,14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;9-8(10)6-13(11,12)7-4-2-1-3-5-7;8-6-7-4-2-1-3-5-7/h1-12H;1-5H,6H2,(H,9,10);1-6H.
What are the key properties of benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene?
benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene has a molecular weight of 550.65 g/mol, XLogP of 5.18, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;2-(benzenesulfonyl)acetic acid;2-(benzenesulfonyl)ethenylbenzene is sourced from PubChem (CID 159600522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).