C9H11NO5S — CID 15217444
2-(4-amino-3-methoxyphenyl)sulfonylacetic acid (PubChem CID 15217444) has the molecular formula C9H11NO5S and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-(4-amino-3-methoxyphenyl)sulfonylacetic acid.
| Compound Name | 2-(4-amino-3-methoxyphenyl)sulfonylacetic acid |
|---|---|
| PubChem CID | 15217444 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(4-amino-3-methoxyphenyl)sulfonylacetic acid |
| SMILES | COc1cc(S(=O)(=O)CC(=O)O)ccc1N |
| InChI | InChI=1S/C9H11NO5S/c1-15-8-4-6(2-3-7(8)10)16(13,14)5-9(11)12/h2-4H,5,10H2,1H3,(H,11,12) |
| InChIKey | GMHUKCGSITYIKX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|