C17H19NO3S2 — CID 71682916
4-phenoxy-N-[(1R,2R)-2-sulfanylcyclopentyl]benzenesulfonamide (PubChem CID 71682916) has the molecular formula C17H19NO3S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-phenoxy-N-[(1R,2R)-2-sulfanylcyclopentyl]benzenesulfonamide.
| Compound Name | 4-phenoxy-N-[(1R,2R)-2-sulfanylcyclopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71682916 |
| Molecular Formula | C17H19NO3S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-phenoxy-N-[(1R,2R)-2-sulfanylcyclopentyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCC[C@H]1S)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO3S2/c19-23(20,18-16-7-4-8-17(16)22)15-11-9-14(10-12-15)21-13-5-2-1-3-6-13/h1-3,5-6,9-12,16-18,22H,4,7-8H2/t16-,17-/m1/s1 |
| InChIKey | YTQYMJLEQVXIPD-IAGOWNOFSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|