C34H40O10S — CID 101382251
trans-tetramethyl (4R,5R)-4-[(E)-4-(4-methylphenyl)sulfonyl-4-phenylbut-1-enyl]-5-prop-2-enylcyclohexane-1,1,2,2-tetracarboxylate (PubChem CID 101382251) has the molecular formula C34H40O10S and a molecular weight of 640.75 g/mol. Its IUPAC name is trans-tetramethyl (4R,5R)-4-[(E)-4-(4-methylphenyl)sulfonyl-4-phenylbut-1-enyl]-5-prop-2-enylcyclohexane-1,1,2,2-tetracarboxylate.
| Compound Name | trans-tetramethyl (4R,5R)-4-[(E)-4-(4-methylphenyl)sulfonyl-4-phenylbut-1-enyl]-5-prop-2-enylcyclohexane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 101382251 |
| Molecular Formula | C34H40O10S |
| Molecular Weight | 640.75 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | trans-tetramethyl (4R,5R)-4-[(E)-4-(4-methylphenyl)sulfonyl-4-phenylbut-1-enyl]-5-prop-2-enylcyclohexane-1,1,2,2-tetracarboxylate |
| SMILES | C=CC[C@@H]1CC(C(=O)OC)(C(=O)OC)C(C(=O)OC)(C(=O)OC)C[C@H]1/C=C/CC(c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H40O10S/c1-7-12-25-21-33(29(35)41-3,30(36)42-4)34(31(37)43-5,32(38)44-6)22-26(25)15-11-16-28(24-13-9-8-10-14-24)45(39,40)27-19-17-23(2)18-20-27/h7-11,13-15,17-20,25-26,28H,1,12,16,21-22H2,2-6H3/b15-11+/t25-,26-,28?/m1/s1 |
| InChIKey | CIKYPVDRLHSJGW-RJRKAUCOSA-N |
| XLogP | 4.72 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|