C25H31NO10S — CID 162401500
tetramethyl 1-ethenyl-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.2.1]nonane-3,3,8,8-tetracarboxylate (PubChem CID 162401500) has the molecular formula C25H31NO10S and a molecular weight of 537.59 g/mol. Its IUPAC name is tetramethyl 1-ethenyl-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.2.1]nonane-3,3,8,8-tetracarboxylate.
| Compound Name | tetramethyl 1-ethenyl-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.2.1]nonane-3,3,8,8-tetracarboxylate |
|---|---|
| PubChem CID | 162401500 |
| Molecular Formula | C25H31NO10S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | tetramethyl 1-ethenyl-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.2.1]nonane-3,3,8,8-tetracarboxylate |
| SMILES | C=CC12CC(CCC(C(=O)OC)(C(=O)OC)C1)N(S(=O)(=O)c1ccc(C)cc1)C2(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C25H31NO10S/c1-7-23-14-17(12-13-24(15-23,19(27)33-3)20(28)34-4)26(25(23,21(29)35-5)22(30)36-6)37(31,32)18-10-8-16(2)9-11-18/h7-11,17H,1,12-15H2,2-6H3 |
| InChIKey | INMAMGWUQVMFMU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|