C17H23NO3S — CID 135078406
(1S,4R)-1-but-3-enyl-4-methoxy-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexane (PubChem CID 135078406) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is (1S,4R)-1-but-3-enyl-4-methoxy-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,4R)-1-but-3-enyl-4-methoxy-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 135078406 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (1S,4R)-1-but-3-enyl-4-methoxy-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexane |
| SMILES | C=CCC[C@]12CC[C@@H](OC)C1N2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO3S/c1-4-5-11-17-12-10-15(21-3)16(17)18(17)22(19,20)14-8-6-13(2)7-9-14/h4,6-9,15-16H,1,5,10-12H2,2-3H3/t15-,16?,17+,18?/m1/s1 |
| InChIKey | VUAZHQUZBRFKKP-ZLZJIPBDSA-N |
| XLogP | 2.88 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|