C26H29NO6S — CID 177412766
dimethyl (1R,2R)-3-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]-3-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-10,10-dicarboxylate (PubChem CID 177412766) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is dimethyl (1R,2R)-3-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]-3-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-10,10-dicarboxylate.
| Compound Name | dimethyl (1R,2R)-3-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]-3-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-10,10-dicarboxylate |
|---|---|
| PubChem CID | 177412766 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | dimethyl (1R,2R)-3-(4-methylphenyl)sulfonyl-2-[(E)-prop-1-enyl]-3-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-10,10-dicarboxylate |
| SMILES | C/C=C/[C@@H]1[C@@H]2CCC(C(=O)OC)(C(=O)OC)Cc3cccc(c32)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H29NO6S/c1-5-7-21-20-14-15-26(24(28)32-3,25(29)33-4)16-18-8-6-9-22(23(18)20)27(21)34(30,31)19-12-10-17(2)11-13-19/h5-13,20-21H,14-16H2,1-4H3/b7-5+/t20-,21+/m0/s1 |
| InChIKey | IXZKAYFZCVLLSV-HEMPXHLYSA-N |
| XLogP | 3.90 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|