C13H20ClNO2S2 — CID 90302746
N-ethyl-1-[(4-methylphenyl)sulfonylsulfanylmethyl]cyclopropan-1-amine;hydrochloride (PubChem CID 90302746) has the molecular formula C13H20ClNO2S2 and a molecular weight of 321.89 g/mol. Its IUPAC name is N-ethyl-1-[(4-methylphenyl)sulfonylsulfanylmethyl]cyclopropan-1-amine;hydrochloride.
| Compound Name | N-ethyl-1-[(4-methylphenyl)sulfonylsulfanylmethyl]cyclopropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 90302746 |
| Molecular Formula | C13H20ClNO2S2 |
| Molecular Weight | 321.89 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-ethyl-1-[(4-methylphenyl)sulfonylsulfanylmethyl]cyclopropan-1-amine;hydrochloride |
| SMILES | CCNC1(CSS(=O)(=O)c2ccc(C)cc2)CC1.Cl |
| InChI | InChI=1S/C13H19NO2S2.ClH/c1-3-14-13(8-9-13)10-17-18(15,16)12-6-4-11(2)5-7-12;/h4-7,14H,3,8-10H2,1-2H3;1H |
| InChIKey | YBNVVOXEHOBDPL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|