C23H23F3N2O4S2 — CID 42705241
N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 42705241) has the molecular formula C23H23F3N2O4S2 and a molecular weight of 512.58 g/mol. Its IUPAC name is N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42705241 |
| Molecular Formula | C23H23F3N2O4S2 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | N-[3-(N-(4-methylphenyl)sulfonylanilino)propyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCNS(=O)(=O)c2cccc(C(F)(F)F)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23F3N2O4S2/c1-18-11-13-21(14-12-18)34(31,32)28(20-8-3-2-4-9-20)16-6-15-27-33(29,30)22-10-5-7-19(17-22)23(24,25)26/h2-5,7-14,17,27H,6,15-16H2,1H3 |
| InChIKey | IGOIXFLEPKXRRP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|