C11H13F3N4O2S — CID 106387073
N-(4-azidobutyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 106387073) has the molecular formula C11H13F3N4O2S and a molecular weight of 322.31 g/mol. Its IUPAC name is N-(4-azidobutyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(4-azidobutyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106387073 |
| Molecular Formula | C11H13F3N4O2S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-(4-azidobutyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | [N-]=[N+]=NCCCCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N4O2S/c12-11(13,14)9-4-3-5-10(8-9)21(19,20)17-7-2-1-6-16-18-15/h3-5,8,17H,1-2,6-7H2 |
| InChIKey | LPQRVCNYHLTGLM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|