C15H21ClN2O4S — CID 11164300
N-(8-amino-1-chloro-2,3-dioxooctan-4-yl)-4-methylbenzenesulfonamide (PubChem CID 11164300) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is N-(8-amino-1-chloro-2,3-dioxooctan-4-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(8-amino-1-chloro-2,3-dioxooctan-4-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11164300 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-(8-amino-1-chloro-2,3-dioxooctan-4-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCCCN)C(=O)C(=O)CCl)cc1 |
| InChI | InChI=1S/C15H21ClN2O4S/c1-11-5-7-12(8-6-11)23(21,22)18-13(4-2-3-9-17)15(20)14(19)10-16/h5-8,13,18H,2-4,9-10,17H2,1H3 |
| InChIKey | IUHGHOVBOZSLNU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|