C7H8F6N2O2 — CID 78146191
(ethylideneamino) N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate (PubChem CID 78146191) has the molecular formula C7H8F6N2O2 and a molecular weight of 266.14 g/mol. Its IUPAC name is (ethylideneamino) N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate.
| Compound Name | (ethylideneamino) N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 78146191 |
| Molecular Formula | C7H8F6N2O2 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (ethylideneamino) N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate |
| SMILES | CC=NOC(=O)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6N2O2/c1-3-14-17-4(16)15-5(2,6(8,9)10)7(11,12)13/h3H,1-2H3,(H,15,16) |
| InChIKey | HFUUTTUWVDOEGB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|