C13H12F9N3O2S — CID 162590489
N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]-3-(trifluoromethyl)benzenesulfonohydrazide (PubChem CID 162590489) has the molecular formula C13H12F9N3O2S and a molecular weight of 445.31 g/mol. Its IUPAC name is N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]-3-(trifluoromethyl)benzenesulfonohydrazide.
| Compound Name | N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]-3-(trifluoromethyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 162590489 |
| Molecular Formula | C13H12F9N3O2S |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]-3-(trifluoromethyl)benzenesulfonohydrazide |
| SMILES | C=C(NNS(=O)(=O)c1cccc(C(F)(F)F)c1)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H12F9N3O2S/c1-7(23-10(2,12(17,18)19)13(20,21)22)24-25-28(26,27)9-5-3-4-8(6-9)11(14,15)16/h3-6,23-25H,1H2,2H3 |
| InChIKey | AUOQYZZCCBOQBG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|